DC Field | Value | Language |
---|---|---|
dc.contributor.author | Lee, C. Y | ko |
dc.contributor.author | Song, Hyunjoon | ko |
dc.contributor.author | Lee, K | ko |
dc.contributor.author | Park, B. K | ko |
dc.contributor.author | Park, Joon Taik | ko |
dc.date.accessioned | 2013-03-03T22:37:46Z | - |
dc.date.available | 2013-03-03T22:37:46Z | - |
dc.date.created | 2012-02-06 | - |
dc.date.created | 2012-02-06 | - |
dc.date.issued | 2004-01 | - |
dc.identifier.citation | INORGANIC SYNTHESES, v.34, no.0, pp.225 - 228 | - |
dc.identifier.uri | http://hdl.handle.net/10203/80753 | - |
dc.language | English | - |
dc.publisher | Wiley | - |
dc.title | Synthesis of Os3(CO)9(m3-h2:h2:h2-C60) and Os3(CO)8(PPh3)(m3-h2:h2:h2-C60) | - |
dc.type | Article | - |
dc.type.rims | ART | - |
dc.citation.volume | 34 | - |
dc.citation.issue | 0 | - |
dc.citation.beginningpage | 225 | - |
dc.citation.endingpage | 228 | - |
dc.citation.publicationname | INORGANIC SYNTHESES | - |
dc.contributor.localauthor | Song, Hyunjoon | - |
dc.contributor.localauthor | Park, Joon Taik | - |
dc.contributor.nonIdAuthor | Lee, C. Y | - |
dc.contributor.nonIdAuthor | Lee, K | - |
dc.contributor.nonIdAuthor | Park, B. K | - |
Items in DSpace are protected by copyright, with all rights reserved, unless otherwise indicated.