A microfluidic platform for a systematic investigation on the effects of a chemical and electrical stimulation to the behaviors of cells under a controllable shear flow
| DC Field | Value | Language |
|---|---|---|
| dc.contributor.author | Ahn, SI | ko |
| dc.contributor.author | Kim, YS | ko |
| dc.contributor.author | Son, MJ | ko |
| dc.contributor.author | Park, EY | ko |
| dc.contributor.author | Song, SH | ko |
| dc.contributor.author | Park, JS | ko |
| dc.contributor.author | Shin, Jennifer Hyunjong | ko |
| dc.date.accessioned | 2014-12-08T08:31:41Z | - |
| dc.date.available | 2014-12-08T08:31:41Z | - |
| dc.date.created | 2014-10-06 | - |
| dc.date.issued | 2014-09-29 | - |
| dc.identifier.citation | Biofabrication2014(ICB2014) | - |
| dc.identifier.uri | http://hdl.handle.net/10203/191602 | - |
| dc.language | English | - |
| dc.publisher | International society for biofabrication | - |
| dc.title | A microfluidic platform for a systematic investigation on the effects of a chemical and electrical stimulation to the behaviors of cells under a controllable shear flow | - |
| dc.type | Conference | - |
| dc.type.rims | CONF | - |
| dc.citation.publicationname | Biofabrication2014(ICB2014) | - |
| dc.identifier.conferencecountry | KO | - |
| dc.identifier.conferencelocation | POSCO International Center, POSTECH | - |
| dc.contributor.localauthor | Shin, Jennifer Hyunjong | - |
| dc.contributor.nonIdAuthor | Ahn, SI | - |
| dc.contributor.nonIdAuthor | Kim, YS | - |
| dc.contributor.nonIdAuthor | Son, MJ | - |
| dc.contributor.nonIdAuthor | Park, EY | - |
| dc.contributor.nonIdAuthor | Song, SH | - |
| dc.contributor.nonIdAuthor | Park, JS | - |
- Appears in Collection
- ME-Conference Papers(학술회의논문)
- Files in This Item
- There are no files associated with this item.
Items in DSpace are protected by copyright, with all rights reserved, unless otherwise indicated.